CAS 56926-94-4 appears in our catalog under these names: Boc–Ser(Tos)–OMe, Boc-Ser(Tos)-OMe, Boc-Ser(Tos)-OMe 97%, Boc-Ser(Tos)-OMe, 97%, 97%, Boc-Ser(Tos)-OMe, 99.84%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 50g, 100g, 250mg, 1g, 5g, 25 g.
Methyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 56926-94-4) is a chemical compound with the molecular formula C16H23NO7S and a molecular weight of 373.4 g/mol. IUPAC name: methyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: VVBLIPVUGGNLGW-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO7S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | methyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | VVBLIPVUGGNLGW-ZDUSSCGKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)