Products 5693-34-5

CAS 5693-34-5 is the registry number for Propyl Gallate Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-[(2,5-dichlorophenyl)sulfonylamino]thiophene-2-carboxylate (CAS 5693-34-5) is a chemical compound with the molecular formula C12H9Cl2NO4S2 and a molecular weight of 366.2 g/mol. IUPAC name: methyl 3-[(2,5-dichlorophenyl)sulfonylamino]thiophene-2-carboxylate. InChIKey: XEYNCYLUBROHMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2NO4S2
Molecular weight366.2 g/mol
IUPAC namemethyl 3-[(2,5-dichlorophenyl)sulfonylamino]thiophene-2-carboxylate
InChIKeyXEYNCYLUBROHMJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CS1)NS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl

Computed by PubChem (NCBI)