CAS 56967-08-9 is the registry number for DMS-612. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-formyl-3-methyl-N-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate (CAS 56967-08-9) is a chemical compound with the molecular formula C14H21NO7S2 and a molecular weight of 379.5 g/mol. IUPAC name: 2-[4-formyl-3-methyl-N-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate. InChIKey: CQVKMVQRSNNAGO-UHFFFAOYSA-N.
| Molecular formula | C14H21NO7S2 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 2-[4-formyl-3-methyl-N-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate |
| InChIKey | CQVKMVQRSNNAGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N(CCOS(=O)(=O)C)CCOS(=O)(=O)C)C=O |
Computed by PubChem (NCBI)