CAS 569679-07-8 is the registry number for (1R,2R,5S)-3-tert-butyl 2-methyl-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-O-tert-butyl 2-O-methyl (1R,2R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylate (CAS 569679-07-8) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 3-O-tert-butyl 2-O-methyl (1R,2R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylate. InChIKey: ANLZCGMJKWMXFP-LPEHRKFASA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 3-O-tert-butyl 2-O-methyl (1R,2R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylate |
| InChIKey | ANLZCGMJKWMXFP-LPEHRKFASA-N |
| SMILES | CC1([C@@H]2[C@H]1[C@@H](N(C2)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)