CAS 56981-41-0 is the registry number for (2R,3R,4S,5S,6R)-2-((6-aminohexyl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S,5S)-2-(6-aminohexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 56981-41-0) is a chemical compound with the molecular formula C12H25NO6 and a molecular weight of 279.33 g/mol. IUPAC name: (2R,4S,5S)-2-(6-aminohexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: GWNKFVGAEZHVTM-RXUZKVILSA-N.
| Molecular formula | C12H25NO6 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R,4S,5S)-2-(6-aminohexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | GWNKFVGAEZHVTM-RXUZKVILSA-N |
| SMILES | C(CCCO[C@H]1C([C@H]([C@@H](C(O1)CO)O)O)O)CCN |
Computed by PubChem (NCBI)