Products 5699-45-6

CAS 5699-45-6 is the registry number for Thymol Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(hydroperoxymethyl)-4-propan-2-ylbenzene (CAS 5699-45-6) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 1-(hydroperoxymethyl)-4-propan-2-ylbenzene. InChIKey: SHBKBGXZURNPEV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O2
Molecular weight166.22 g/mol
IUPAC name1-(hydroperoxymethyl)-4-propan-2-ylbenzene
InChIKeySHBKBGXZURNPEV-UHFFFAOYSA-N
SMILESCC(C)C1=CC=C(C=C1)COO

Computed by PubChem (NCBI)