CAS 57008-25-0 is the registry number for 2-(2,2,2-Trifluoroethanesulfonyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,2,2-trifluoroethylsulfonyl)acetic acid (CAS 57008-25-0) is a chemical compound with the molecular formula C4H5F3O4S and a molecular weight of 206.14 g/mol. IUPAC name: 2-(2,2,2-trifluoroethylsulfonyl)acetic acid. InChIKey: FIULQBJUTSDMEI-UHFFFAOYSA-N.
| Molecular formula | C4H5F3O4S |
|---|---|
| Molecular weight | 206.14 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethylsulfonyl)acetic acid |
| InChIKey | FIULQBJUTSDMEI-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)S(=O)(=O)CC(F)(F)F |
Computed by PubChem (NCBI)