CAS 57009-15-1 is the registry number for Isocromil. Offered by: TRC. Available pack sizes: 100mg.
4-oxo-2-(2-propan-2-yloxyphenyl)chromene-6-carboxylic acid (CAS 57009-15-1) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 324.3 g/mol. IUPAC name: 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-6-carboxylic acid. InChIKey: YLQMFQKRHQCFBI-UHFFFAOYSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-6-carboxylic acid |
| InChIKey | YLQMFQKRHQCFBI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC=C1C2=CC(=O)C3=C(O2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)