Products 570394-17-1
CAS 570394-17-1 appears in our catalog under these names: 4-Acetamidophenyl beta-d-glucuronic acid, methyl ester, 95%, 4-Acetamidophenyl Beta-D-Glucuronic Acid Methyl Ester, 4-Acetamidophenyl β-D-glucuronide methyl ester, β-D-Glucopyranosiduronic acid, 4-(acetylamino)phenyl, methyl ester. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 50mg, 500mg, 25 mg, 50 mg, 100 mg.
Methyl (2S,3S,4S,5R,6S)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate (CAS 570394-17-1) is a chemical compound with the molecular formula C15H19NO8 and a molecular weight of 341.31 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate. InChIKey: PBCDFJAIFOUUBQ-DKBOKBLXSA-N.
| Molecular formula | C15H19NO8 |
|---|---|
| Molecular weight | 341.31 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| InChIKey | PBCDFJAIFOUUBQ-DKBOKBLXSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)OC)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Acetamidophenyl b-D-glucuronide methyl ester, 4-Acetamidophenyl beta-D-Glucuronic Acid Methyl Ester, 4-Acetamidophenyl beta-d-glucuronic acid, methyl ester, 4-Acetamidophenyl ?-D-Glucuronic Acid Methyl Ester, 4-Acetamidophenyl b-D-glucuronic acid methyl ester, orb2941472, 4-Acetamidophenyl ?-D-glucuronide methyl ester