CAS 5704-60-9 appears in our catalog under these names: Nifenalol (hydrochloride), nifenalol.HCl/ 99.97% (existing batch purity), 1-(4-Nitrophenyl)-1-hydroxy-2-isopropylaminoethane hydrochloride, 98%, 98%, Nifenalol (hydrochloride), 99.93%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 100 mg, 10 mg, 25 mg.
1-(4-nitrophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride (CAS 5704-60-9) is a chemical compound with the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. IUPAC name: 1-(4-nitrophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride. InChIKey: STGOXRVTUNXXLQ-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O3 |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride |
| InChIKey | STGOXRVTUNXXLQ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC=C(C=C1)[N+](=O)[O-])O.Cl |
Computed by PubChem (NCBI)