CAS 5710-54-3 appears in our catalog under these names: 1,2–BENZENEDISULFONIC ACID, DIPOTASSIUM SALT, POTASSIUM BENZENE-1,2-DISULFONATE, 98%, Potassium benzene-1,2-disulfonate. Offered by: GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 10G.
Dipotassium;benzene-1,2-disulfonate (CAS 5710-54-3) is a chemical compound with the molecular formula C6H4K2O6S2 and a molecular weight of 314.4 g/mol. IUPAC name: dipotassium;benzene-1,2-disulfonate. InChIKey: WUERIJJOLNKVMO-UHFFFAOYSA-L.
| Molecular formula | C6H4K2O6S2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | dipotassium;benzene-1,2-disulfonate |
| InChIKey | WUERIJJOLNKVMO-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)