CAS 57102-64-4 is the registry number for 6,6'-Diiodo-9,9'-diphenyl-9H,9'H-3,3'-bicarbazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-6-(6-iodo-9-phenylcarbazol-3-yl)-9-phenylcarbazole (CAS 57102-64-4) is a chemical compound with the molecular formula C36H22I2N2 and a molecular weight of 736.4 g/mol. IUPAC name: 3-iodo-6-(6-iodo-9-phenylcarbazol-3-yl)-9-phenylcarbazole. InChIKey: CRUZHVWPOCKMLQ-UHFFFAOYSA-N.
| Molecular formula | C36H22I2N2 |
|---|---|
| Molecular weight | 736.4 g/mol |
| IUPAC name | 3-iodo-6-(6-iodo-9-phenylcarbazol-3-yl)-9-phenylcarbazole |
| InChIKey | CRUZHVWPOCKMLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC5=C(C=C4)N(C6=C5C=C(C=C6)I)C7=CC=CC=C7)C8=C2C=CC(=C8)I |
Computed by PubChem (NCBI)