CAS 57102-97-3 appears in our catalog under these names: 3–Bromo–9–ethylcarbazole, 3-Bromo-9-ethylcarbazole, >98.0%(GC), 3-Bromo-9-ethyl-9H-carbazole 95%, 3-Bromo-9-ethyl-9H-carbazole, 95%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
3-bromo-9-ethylcarbazole (CAS 57102-97-3) is a chemical compound with the molecular formula C14H12BrN and a molecular weight of 274.15 g/mol. IUPAC name: 3-bromo-9-ethylcarbazole. InChIKey: PPHYYUDMDADQPF-UHFFFAOYSA-N.
| Molecular formula | C14H12BrN |
|---|---|
| Molecular weight | 274.15 g/mol |
| IUPAC name | 3-bromo-9-ethylcarbazole |
| InChIKey | PPHYYUDMDADQPF-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Br)C3=CC=CC=C31 |
Computed by PubChem (NCBI)