Products 57110-29-9
CAS 57110-29-9 appears in our catalog under these names: 3-Methylhexahydrophthalic Anhydride, 3-Methyl-1,2-cyclohexanedicarboxylic acid anhydride, 4-Methylhexahydroisobenzofuran-1,3-dione. Offered by: TRC, Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 10mg, 25 mg, 50 mg, 100 mg, 10 mg.
(3aR,7aS)-4-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (CAS 57110-29-9) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: (3aR,7aS)-4-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione. InChIKey: QXBYUPMEYVDXIQ-BOJSHJERSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (3aR,7aS)-4-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| InChIKey | QXBYUPMEYVDXIQ-BOJSHJERSA-N |
| SMILES | CC1CCC[C@H]2[C@@H]1C(=O)OC2=O |
Computed by PubChem (NCBI)