CAS 571151-21-8 appears in our catalog under these names: 4-(4-Methyl-thiazol-2-ylsulfanyl)-3-nitro-benzoic acid, 95%, 4-((4-Methyl-1,3-thiazol-2-yl)sulfanyl)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoic acid (CAS 571151-21-8) is a chemical compound with the molecular formula C11H8N2O4S2 and a molecular weight of 296.3 g/mol. IUPAC name: 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoic acid. InChIKey: XTDFJOXOUFCPAI-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4S2 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoic acid |
| InChIKey | XTDFJOXOUFCPAI-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)SC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)