CAS 571161-42-7 appears in our catalog under these names: 4-(4-Acetyl-phenylamino)-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one, 95%, 4-((4-Acetylphenyl)amino)-1,5-dimethyl-2-phenyl-2,3-dihydro-1H-pyrazol-3-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(4-acetylanilino)-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 571161-42-7) is a chemical compound with the molecular formula C19H19N3O2 and a molecular weight of 321.4 g/mol. IUPAC name: 4-(4-acetylanilino)-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: QTWITAAHGCXTHH-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O2 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-(4-acetylanilino)-1,5-dimethyl-2-phenylpyrazol-3-one |
| InChIKey | QTWITAAHGCXTHH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC3=CC=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)