CAS 5714-08-9 appears in our catalog under these names: Liothyronine related impurity, (R)-2-amino, (R)-2-Amino-3-(4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl)propanoic acid, 98%, 3,3’,5-Triiodo-D-thyronine, >95% (HPLC), 3,5,3'-Triiodo-D-thyronine, 95.29%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 5 mg, 10 mg, 1 mg.
(2R)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid (CAS 5714-08-9) is a chemical compound with the molecular formula C15H12I3NO4 and a molecular weight of 650.97 g/mol. IUPAC name: (2R)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: AUYYCJSJGJYCDS-GFCCVEGCSA-N.
| Molecular formula | C15H12I3NO4 |
|---|---|
| Molecular weight | 650.97 g/mol |
| IUPAC name | (2R)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | AUYYCJSJGJYCDS-GFCCVEGCSA-N |
| SMILES | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)C[C@H](C(=O)O)N)I)I)O |
Computed by PubChem (NCBI)