CAS 5714-17-0 appears in our catalog under these names: 5-Chloro-4-nitro-2,1,3-benzoxadiazole, 95%, 5-Chloro-4-nitro-2,1,3-benzoxadiazole. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 2.5g.
5-chloro-4-nitro-2,1,3-benzoxadiazole (CAS 5714-17-0) is a chemical compound with the molecular formula C6H2ClN3O3 and a molecular weight of 199.55 g/mol. IUPAC name: 5-chloro-4-nitro-2,1,3-benzoxadiazole. InChIKey: JJXNKZYCHQVCND-UHFFFAOYSA-N.
| Molecular formula | C6H2ClN3O3 |
|---|---|
| Molecular weight | 199.55 g/mol |
| IUPAC name | 5-chloro-4-nitro-2,1,3-benzoxadiazole |
| InChIKey | JJXNKZYCHQVCND-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)