CAS 57155-57-4 is the registry number for 1,4–Phenylenebis(diphenylmethanol). Offered by: GLPBio. Available pack sizes: 5g.
[4-[hydroxy(diphenyl)methyl]phenyl]-diphenylmethanol (CAS 57155-57-4) is a chemical compound with the molecular formula C32H26O2 and a molecular weight of 442.5 g/mol. IUPAC name: [4-[hydroxy(diphenyl)methyl]phenyl]-diphenylmethanol. InChIKey: KZTBUDZYXNLPIK-UHFFFAOYSA-N.
| Molecular formula | C32H26O2 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | [4-[hydroxy(diphenyl)methyl]phenyl]-diphenylmethanol |
| InChIKey | KZTBUDZYXNLPIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)C(C4=CC=CC=C4)(C5=CC=CC=C5)O)O |
Computed by PubChem (NCBI)