CAS 57165-41-0 appears in our catalog under these names: Indoramin D5, Indoramin-d5 (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Indoramin D5 (Indoramine D5), Indoramin-d5, 98.0%. Offered by: Chemat Brand, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 1mg, 5mg.
2,3,4,5,6-pentadeuterio-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]benzamide (CAS 57165-41-0) is a chemical compound with the molecular formula C22H25N3O and a molecular weight of 352.5 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]benzamide. InChIKey: JXZZEXZZKAWDSP-FSTBWYLISA-N.
| Molecular formula | C22H25N3O |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuterio-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]benzamide |
| InChIKey | JXZZEXZZKAWDSP-FSTBWYLISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)NC2CCN(CC2)CCC3=CNC4=CC=CC=C43)[2H])[2H] |
Computed by PubChem (NCBI)