Products 57182-70-4

CAS 57182-70-4 appears in our catalog under these names: 2,4-Dimethylthiobenzamide, 95%, 2,4-Dimethylbenzothioamide, 97%, 2,4-Dimethylbenzene-1-carbothioamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.

Structural formula: {0} (CAS {1})

2,4-dimethylbenzenecarbothioamide (CAS 57182-70-4) is a chemical compound with the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. IUPAC name: 2,4-dimethylbenzenecarbothioamide. InChIKey: UQGIEZGCCUAUGR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NS
Molecular weight165.26 g/mol
IUPAC name2,4-dimethylbenzenecarbothioamide
InChIKeyUQGIEZGCCUAUGR-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C(=S)N)C

Computed by PubChem (NCBI)