CAS 571920-84-8 appears in our catalog under these names: 2-Bromo-n-(2-chloro-acetyl)-benzamide, 95%, 2-Bromo-N-(2-chloroacetyl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-N-(2-chloroacetyl)benzamide (CAS 571920-84-8) is a chemical compound with the molecular formula C9H7BrClNO2 and a molecular weight of 276.51 g/mol. IUPAC name: 2-bromo-N-(2-chloroacetyl)benzamide. InChIKey: JMARHYIKZSUVLB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO2 |
|---|---|
| Molecular weight | 276.51 g/mol |
| IUPAC name | 2-bromo-N-(2-chloroacetyl)benzamide |
| InChIKey | JMARHYIKZSUVLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC(=O)CCl)Br |
Computed by PubChem (NCBI)