Products 5720-12-7
CAS 5720-12-7 is the registry number for 7,8-diethylflavin. Offered by: Chemat. Available pack sizes: 100mg.
7,8-diethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione (CAS 5720-12-7) is a chemical compound with the molecular formula C19H24N4O6 and a molecular weight of 404.4 g/mol. IUPAC name: 7,8-diethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione. InChIKey: TZVMOPMDLUJXPI-LZWOXQAQSA-N.
| Molecular formula | C19H24N4O6 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 7,8-diethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
| InChIKey | TZVMOPMDLUJXPI-LZWOXQAQSA-N |
| SMILES | CCC1=CC2=C(C=C1CC)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)