CAS 57236-72-3 is the registry number for 1-O-Acetyl-2-deoxy-3,5-di-O-toluoyl-b-D-erythropentofuranose. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
[(2R,3S,5S)-5-acetyloxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 57236-72-3) is a chemical compound with the molecular formula C23H24O7 and a molecular weight of 412.4 g/mol. IUPAC name: [(2R,3S,5S)-5-acetyloxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: AEEIKTDMFUOGDM-PWRODBHTSA-N.
| Molecular formula | C23H24O7 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | [(2R,3S,5S)-5-acetyloxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | AEEIKTDMFUOGDM-PWRODBHTSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](C[C@@H](O2)OC(=O)C)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)