CAS 57268-33-4 appears in our catalog under these names: Dantrolene Impurity 2, 5-(4-Nitrophenyl)-2-furaldehyde-(2-carboxymethyl) Semicarbazone, >95% (HPLC), N-Carbamoyl-N-(((5-(4-nitrophenyl)furan-2-yl)methylene)amino)glycine, 98%, ((Aminocarbonyl)((5-(4-nitrophenyl)-2-furanyl)methylene)hydrazino)-acetic acid. Offered by: Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: on request, 10mg, 50mg, 1g, 5g, 5mg, 1mg, 25mg.
2-[carbamoyl-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]acetic acid (CAS 57268-33-4) is a chemical compound with the molecular formula C14H12N4O6 and a molecular weight of 332.27 g/mol. IUPAC name: 2-[carbamoyl-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]acetic acid. InChIKey: RGDXLIJGJXVFDO-APSNUPSMSA-N.
| Molecular formula | C14H12N4O6 |
|---|---|
| Molecular weight | 332.27 g/mol |
| IUPAC name | 2-[carbamoyl-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]acetic acid |
| InChIKey | RGDXLIJGJXVFDO-APSNUPSMSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)/C=N\N(CC(=O)O)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)