CAS 57322-42-6 appears in our catalog under these names: Alphamine red r base, 95%, Alphamine Red R Base. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 200mg.
3-[(4-anilinonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid (CAS 57322-42-6) is a chemical compound with the molecular formula C26H19N3O6S2 and a molecular weight of 533.6 g/mol. IUPAC name: 3-[(4-anilinonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid. InChIKey: BGHIEJHQLIHWPX-UHFFFAOYSA-N.
| Molecular formula | C26H19N3O6S2 |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | 3-[(4-anilinonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid |
| InChIKey | BGHIEJHQLIHWPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C3=CC=CC=C32)N=NC4=C(C=C5C=C(C=CC5=C4)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)