Products 57322-42-6

CAS 57322-42-6 appears in our catalog under these names: Alphamine red r base, 95%, Alphamine Red R Base. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 200mg.

Structural formula: {0} (CAS {1})

3-[(4-anilinonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid (CAS 57322-42-6) is a chemical compound with the molecular formula C26H19N3O6S2 and a molecular weight of 533.6 g/mol. IUPAC name: 3-[(4-anilinonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid. InChIKey: BGHIEJHQLIHWPX-UHFFFAOYSA-N.

Identity
Molecular formulaC26H19N3O6S2
Molecular weight533.6 g/mol
IUPAC name3-[(4-anilinonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid
InChIKeyBGHIEJHQLIHWPX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC2=CC=C(C3=CC=CC=C32)N=NC4=C(C=C5C=C(C=CC5=C4)S(=O)(=O)O)S(=O)(=O)O

Computed by PubChem (NCBI)