CAS 57341-16-9 appears in our catalog under these names: Potassium D–tartrate monobasic, Potassium D-tartrate monobasic. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10g, 25g, Get quote.
Potassium (2S,3S)-2,3,4-trihydroxy-4-oxobutanoate (CAS 57341-16-9) is a chemical compound with the molecular formula C4H5KO6 and a molecular weight of 188.18 g/mol. IUPAC name: potassium (2S,3S)-2,3,4-trihydroxy-4-oxobutanoate. InChIKey: KYKNRZGSIGMXFH-YGEZSCCGSA-M.
| Molecular formula | C4H5KO6 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | potassium (2S,3S)-2,3,4-trihydroxy-4-oxobutanoate |
| InChIKey | KYKNRZGSIGMXFH-YGEZSCCGSA-M |
| SMILES | [C@H]([C@@H](C(=O)[O-])O)(C(=O)O)O.[K+] |
Computed by PubChem (NCBI)