Products 57371-40-1
CAS 57371-40-1 appears in our catalog under these names: 1-Nitrosopyrrolidine-d4, 1-Nitrosopyrrolidine-d4, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 1 mg, 5 mg, 50mg, 5mg.
2,2,5,5-tetradeuterio-1-nitrosopyrrolidine (CAS 57371-40-1) is a chemical compound with the molecular formula C4H8N2O and a molecular weight of 104.14 g/mol. IUPAC name: 2,2,5,5-tetradeuterio-1-nitrosopyrrolidine. InChIKey: WNYADZVDBIBLJJ-KHORGVISSA-N.
| Molecular formula | C4H8N2O |
|---|---|
| Molecular weight | 104.14 g/mol |
| IUPAC name | 2,2,5,5-tetradeuterio-1-nitrosopyrrolidine |
| InChIKey | WNYADZVDBIBLJJ-KHORGVISSA-N |
| SMILES | [2H]C1(CCC(N1N=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)