Products 57378-68-4
CAS 57378-68-4 appears in our catalog under these names: Delta-Damascone, Delta Damascone, δ-Damascone, 1-(2,6,6-Trimethylcyclohex-3-en-1-yl)but-2-en-1-one 97%, δ-Damascone, 97%, 97%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100g, 1g, 25g, 500g, 5g, 250g, 1ML.
(E)-1-(2,6,6-trimethylcyclohex-3-en-1-yl)but-2-en-1-one (CAS 57378-68-4) is a chemical compound with the molecular formula C13H20O and a molecular weight of 192.30 g/mol. IUPAC name: (E)-1-(2,6,6-trimethylcyclohex-3-en-1-yl)but-2-en-1-one. InChIKey: XEJGJTYRUWUFFD-FNORWQNLSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | (E)-1-(2,6,6-trimethylcyclohex-3-en-1-yl)but-2-en-1-one |
| InChIKey | XEJGJTYRUWUFFD-FNORWQNLSA-N |
| SMILES | C/C=C/C(=O)C1C(C=CCC1(C)C)C |
Computed by PubChem (NCBI)