Products 5739-85-5
CAS 5739-85-5 is the registry number for Pyrenophorin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100μg, 500μg, 1mg, Get quote.
(3Z,8R,11Z,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone (CAS 5739-85-5) is a chemical compound with the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. IUPAC name: (3Z,8R,11Z,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone. InChIKey: PJHRIHGUXQTQLU-WICDBLAJSA-N.
| Molecular formula | C16H20O6 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (3Z,8R,11Z,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone |
| InChIKey | PJHRIHGUXQTQLU-WICDBLAJSA-N |
| SMILES | C[C@H]1OC(=O)/C=C\C(=O)CC[C@H](OC(=O)/C=C\C(=O)CC1)C |
Computed by PubChem (NCBI)