CAS 573987-70-9 is the registry number for (5S)-2-Chloro-3-methyl-5-phenyl-1,3,2-oxazaphospholidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-2-chloro-3-methyl-5-phenyl-1,3,2-oxazaphospholidine (CAS 573987-70-9) is a chemical compound with the molecular formula C9H11ClNOP and a molecular weight of 215.61 g/mol. IUPAC name: (5S)-2-chloro-3-methyl-5-phenyl-1,3,2-oxazaphospholidine. InChIKey: RGVPAVYGPVWCBR-CGCSKFHYSA-N.
| Molecular formula | C9H11ClNOP |
|---|---|
| Molecular weight | 215.61 g/mol |
| IUPAC name | (5S)-2-chloro-3-methyl-5-phenyl-1,3,2-oxazaphospholidine |
| InChIKey | RGVPAVYGPVWCBR-CGCSKFHYSA-N |
| SMILES | CN1C[C@@H](OP1Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)