CAS 57401-82-8 is the registry number for Betameprodine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
[(3R,4R)-3-ethyl-1-methyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride (CAS 57401-82-8) is a chemical compound with the molecular formula C17H26ClNO2 and a molecular weight of 311.8 g/mol. IUPAC name: [(3R,4R)-3-ethyl-1-methyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride. InChIKey: MHZBPWPPBRJQTI-SATBOSKTSA-N.
| Molecular formula | C17H26ClNO2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | [(3R,4R)-3-ethyl-1-methyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride |
| InChIKey | MHZBPWPPBRJQTI-SATBOSKTSA-N |
| SMILES | CC[C@@H]1CN(CC[C@@]1(C2=CC=CC=C2)OC(=O)CC)C.Cl |
Computed by PubChem (NCBI)