Products 57414-76-3
CAS 57414-76-3 appears in our catalog under these names: 3-Amino-2-methyl-benzyl-d2 Alcohol, 3–Amino–2–methyl–benzyl–d2 Alcohol. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg.
(3-amino-2-methylphenyl)-dideuteriomethanol (CAS 57414-76-3) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 139.19 g/mol. IUPAC name: (3-amino-2-methylphenyl)-dideuteriomethanol. InChIKey: UVYZMJMDIMWDNJ-BFWBPSQCSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 139.19 g/mol |
| IUPAC name | (3-amino-2-methylphenyl)-dideuteriomethanol |
| InChIKey | UVYZMJMDIMWDNJ-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C1=C(C(=CC=C1)N)C)O |
Computed by PubChem (NCBI)