Products 57414-77-4
CAS 57414-77-4 appears in our catalog under these names: 3-Amino-2-methyl-benzyl-d2 Bromide Hydrobromide, 3–Amino–2–methyl–benzyl–d2 Bromide Hydrobromide. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 5mg.
3-[bromo(dideuterio)methyl]-2-methylaniline;hydrobromide (CAS 57414-77-4) is a chemical compound with the molecular formula C8H11Br2N and a molecular weight of 283.00 g/mol. IUPAC name: 3-[bromo(dideuterio)methyl]-2-methylaniline;hydrobromide. InChIKey: SEHHMAHTMXMBDI-QPMNBSDMSA-N.
| Molecular formula | C8H11Br2N |
|---|---|
| Molecular weight | 283.00 g/mol |
| IUPAC name | 3-[bromo(dideuterio)methyl]-2-methylaniline;hydrobromide |
| InChIKey | SEHHMAHTMXMBDI-QPMNBSDMSA-N |
| SMILES | [2H]C([2H])(C1=C(C(=CC=C1)N)C)Br.Br |
Computed by PubChem (NCBI)