CAS 57414-78-5 is the registry number for 2,3-Dimethylaniline-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-methyl-3-(trideuteriomethyl)aniline (CAS 57414-78-5) is a chemical compound with the molecular formula C8H11N and a molecular weight of 124.20 g/mol. IUPAC name: 2-methyl-3-(trideuteriomethyl)aniline. InChIKey: VVAKEQGKZNKUSU-FIBGUPNXSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 124.20 g/mol |
| IUPAC name | 2-methyl-3-(trideuteriomethyl)aniline |
| InChIKey | VVAKEQGKZNKUSU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)N)C |
Computed by PubChem (NCBI)