Products 57444-27-6

CAS 57444-27-6 is the registry number for 2-Methyl-d3-3-butyn-1,1,1-d3-2-ol, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,1,1-trideuterio-2-(trideuteriomethyl)but-3-yn-2-ol (CAS 57444-27-6) is a chemical compound with the molecular formula C5H8O and a molecular weight of 90.15 g/mol. IUPAC name: 1,1,1-trideuterio-2-(trideuteriomethyl)but-3-yn-2-ol. InChIKey: CEBKHWWANWSNTI-XERRXZQWSA-N.

Identity
Molecular formulaC5H8O
Molecular weight90.15 g/mol
IUPAC name1,1,1-trideuterio-2-(trideuteriomethyl)but-3-yn-2-ol
InChIKeyCEBKHWWANWSNTI-XERRXZQWSA-N
SMILES[2H]C([2H])([2H])C(C#C)(C([2H])([2H])[2H])O

Computed by PubChem (NCBI)