CAS 57457-65-5 is the registry number for Amoxicillin Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[[2-amino-2-(4-hydroxyphenyl)acetyl]amino]-carboxymethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 57457-65-5) is a chemical compound with the molecular formula C16H21N3O6S and a molecular weight of 383.4 g/mol. IUPAC name: 2-[[[2-amino-2-(4-hydroxyphenyl)acetyl]amino]-carboxymethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: LHHKJQFIKHAUIA-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O6S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 2-[[[2-amino-2-(4-hydroxyphenyl)acetyl]amino]-carboxymethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | LHHKJQFIKHAUIA-UHFFFAOYSA-N |
| SMILES | CC1(C(NC(S1)C(C(=O)O)NC(=O)C(C2=CC=C(C=C2)O)N)C(=O)O)C |
Computed by PubChem (NCBI)