Products 57457-66-6
CAS 57457-66-6 appears in our catalog under these names: Ampicillinoic acid, Ampicillin Impurity 22. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[(2-amino-2-phenylacetyl)amino]-carboxymethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 57457-66-6) is a chemical compound with the molecular formula C16H21N3O5S and a molecular weight of 367.4 g/mol. IUPAC name: 2-[[(2-amino-2-phenylacetyl)amino]-carboxymethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: KDAWOPKDXRJNHV-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O5S |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 2-[[(2-amino-2-phenylacetyl)amino]-carboxymethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | KDAWOPKDXRJNHV-UHFFFAOYSA-N |
| SMILES | CC1(C(NC(S1)C(C(=O)O)NC(=O)C(C2=CC=CC=C2)N)C(=O)O)C |
Computed by PubChem (NCBI)