CAS 5746-17-8 is the registry number for Dichlorprop Potassium Salt. Offered by: TRC. Available pack sizes: 1g.
Potassium 2-(2,4-dichlorophenoxy)propanoate (CAS 5746-17-8) is a chemical compound with the molecular formula C9H7Cl2KO3 and a molecular weight of 273.15 g/mol. IUPAC name: potassium 2-(2,4-dichlorophenoxy)propanoate. InChIKey: SIVJKMBJGCUUNS-UHFFFAOYSA-M.
| Molecular formula | C9H7Cl2KO3 |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | potassium 2-(2,4-dichlorophenoxy)propanoate |
| InChIKey | SIVJKMBJGCUUNS-UHFFFAOYSA-M |
| SMILES | CC(C(=O)[O-])OC1=C(C=C(C=C1)Cl)Cl.[K+] |
Computed by PubChem (NCBI)