CAS 5746-18-9 appears in our catalog under these names: 4-Carboxy-1-methylpyridin-1-ium chloride, 95+%, QINA. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
1-methylpyridin-1-ium-4-carboxylic acid chloride (CAS 5746-18-9) is a chemical compound with the molecular formula C7H8ClNO2 and a molecular weight of 173.60 g/mol. IUPAC name: 1-methylpyridin-1-ium-4-carboxylic acid chloride. InChIKey: XGRUGEJMSKBMPC-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO2 |
|---|---|
| Molecular weight | 173.60 g/mol |
| IUPAC name | 1-methylpyridin-1-ium-4-carboxylic acid chloride |
| InChIKey | XGRUGEJMSKBMPC-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=C(C=C1)C(=O)O.[Cl-] |
Computed by PubChem (NCBI)