CAS 57469-82-6 appears in our catalog under these names: (S)-2-Amino-5-guanidinopentanoic acid compound with 2-(4-isobutylphenyl)propanoic acid (1:1), 95%, (S)-2-Amino-5-guanidinopentanoic acid compound with 2-(4-isobutylphenyl)propanoic acid (1:1), 56.85%, 56.85%, Ibuprofen arginine. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 25mg, Get quote.
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 57469-82-6) is a chemical compound with the molecular formula C19H32N4O4 and a molecular weight of 380.5 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: GCCOJNYCFNSJII-VWMHFEHESA-N.
| Molecular formula | C19H32N4O4 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | GCCOJNYCFNSJII-VWMHFEHESA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O.C(C[C@@H](C(=O)O)N)CN=C(N)N |
Computed by PubChem (NCBI)