CAS 57495-14-4 appears in our catalog under these names: Ketoprofen Sodium Salt, Ketoprofen sodium 98%, Ketoprofen sodium, 98%, 98%, Ketoprofen (sodium). Offered by: Chemat Brand, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 250mg, 1g, 5g, 1 g, 50 mg, 100 mg, 25 mg.
Sodium 2-(3-benzoylphenyl)propanoate (CAS 57495-14-4) is a chemical compound with the molecular formula C16H13NaO3 and a molecular weight of 276.26 g/mol. IUPAC name: sodium 2-(3-benzoylphenyl)propanoate. InChIKey: OAPDLBHLMVYMCW-UHFFFAOYSA-M.
| Molecular formula | C16H13NaO3 |
|---|---|
| Molecular weight | 276.26 g/mol |
| IUPAC name | sodium 2-(3-benzoylphenyl)propanoate |
| InChIKey | OAPDLBHLMVYMCW-UHFFFAOYSA-M |
| SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)