CAS 57495-46-2 is the registry number for L-Threitol-1,4-ditosylate. Offered by: TRC. Available pack sizes: 10g, 2,5g, 500mg.
[(2S,3S)-2,3-dihydroxy-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate (CAS 57495-46-2) is a chemical compound with the molecular formula C18H22O8S2 and a molecular weight of 430.5 g/mol. IUPAC name: [(2S,3S)-2,3-dihydroxy-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate. InChIKey: FOQGPMGPNUYCOK-ROUUACIJSA-N.
| Molecular formula | C18H22O8S2 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | [(2S,3S)-2,3-dihydroxy-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
| InChIKey | FOQGPMGPNUYCOK-ROUUACIJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]([C@H](COS(=O)(=O)C2=CC=C(C=C2)C)O)O |
Computed by PubChem (NCBI)