Products 575-38-2
CAS 575-38-2 appears in our catalog under these names: 1,7-Dihydroxynaphthalene, >95% (HPLC), 1,7–Dihydroxynaphthalene, 1,7-Dihydroxynaphthalene, 97% , 1,7-Dihydroxynaphthalene, >98.0%(GC), 1,7-Dihydroxynaphthalene 95%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 5g, 100g, 25g, 500g, 1g.
Naphthalene-1,7-diol (CAS 575-38-2) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: naphthalene-1,7-diol. InChIKey: ZUVBIBLYOCVYJU-UHFFFAOYSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | naphthalene-1,7-diol |
| InChIKey | ZUVBIBLYOCVYJU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)O |
Computed by PubChem (NCBI)