CAS 57530-40-2 appears in our catalog under these names: Ethacizine HCl, 98%, Ethacizine hydrochloride, Ethacizine hydrochloride, Ethyl (10-(3-(diethylamino)propanoyl)-10H-phenothiazin-2-yl)carbamate hydrochloride, Ethacizine (hydrochloride), 99.25%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 50 mg.
Ethyl N-[10-[3-(diethylamino)propanoyl]phenothiazin-2-yl]carbamate;hydrochloride (CAS 57530-40-2) is a chemical compound with the molecular formula C22H28ClN3O3S and a molecular weight of 450.0 g/mol. IUPAC name: ethyl N-[10-[3-(diethylamino)propanoyl]phenothiazin-2-yl]carbamate;hydrochloride. InChIKey: VHNXQKLWIQHSOY-UHFFFAOYSA-N.
| Molecular formula | C22H28ClN3O3S |
|---|---|
| Molecular weight | 450.0 g/mol |
| IUPAC name | ethyl N-[10-[3-(diethylamino)propanoyl]phenothiazin-2-yl]carbamate;hydrochloride |
| InChIKey | VHNXQKLWIQHSOY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(=O)N1C2=CC=CC=C2SC3=C1C=C(C=C3)NC(=O)OCC.Cl |
Computed by PubChem (NCBI)