CAS 57531-87-0 is the registry number for 2,4,5-Trichloro-6-Methoxyisophthalonitrile. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,5-trichloro-6-methoxybenzene-1,3-dicarbonitrile (CAS 57531-87-0) is a chemical compound with the molecular formula C9H3Cl3N2O and a molecular weight of 261.5 g/mol. IUPAC name: 2,4,5-trichloro-6-methoxybenzene-1,3-dicarbonitrile. InChIKey: UXQSHXVXPDJKJU-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl3N2O |
|---|---|
| Molecular weight | 261.5 g/mol |
| IUPAC name | 2,4,5-trichloro-6-methoxybenzene-1,3-dicarbonitrile |
| InChIKey | UXQSHXVXPDJKJU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1Cl)Cl)C#N)Cl)C#N |
Computed by PubChem (NCBI)