CAS 57568-80-6 appears in our catalog under these names: PNU 37883 hydrochloride, PNU 37883 hydrochloride, N'-(Adamantan-1-yl)-N-cyclohexylmorpholine-4-carboximidamide hydrochloride, 98%, 98%, PNU 37883 (hydrochloride), 99.66%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 25mg, 50mg, 100mg, 10mg, 10 mg, 5 mg.
N-(1-adamantyl)-N'-cyclohexylmorpholine-4-carboximidamide;hydrochloride (CAS 57568-80-6) is a chemical compound with the molecular formula C21H36ClN3O and a molecular weight of 382.0 g/mol. IUPAC name: N-(1-adamantyl)-N'-cyclohexylmorpholine-4-carboximidamide;hydrochloride. InChIKey: FZALCKUJYZCDOX-UHFFFAOYSA-N.
| Molecular formula | C21H36ClN3O |
|---|---|
| Molecular weight | 382.0 g/mol |
| IUPAC name | N-(1-adamantyl)-N'-cyclohexylmorpholine-4-carboximidamide;hydrochloride |
| InChIKey | FZALCKUJYZCDOX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N=C(NC23CC4CC(C2)CC(C4)C3)N5CCOCC5.Cl |
Computed by PubChem (NCBI)