CAS 57575-15-2 is the registry number for 2,2,2-Tribromoethyl Phosphoromorpholinochloridate. Offered by: TRC. Available pack sizes: 5g.
4-[chloro(2,2,2-tribromoethoxy)phosphoryl]morpholine (CAS 57575-15-2) is a chemical compound with the molecular formula C6H10Br3ClNO3P and a molecular weight of 450.29 g/mol. IUPAC name: 4-[chloro(2,2,2-tribromoethoxy)phosphoryl]morpholine. InChIKey: LROSUTJPBMEPEY-UHFFFAOYSA-N.
| Molecular formula | C6H10Br3ClNO3P |
|---|---|
| Molecular weight | 450.29 g/mol |
| IUPAC name | 4-[chloro(2,2,2-tribromoethoxy)phosphoryl]morpholine |
| InChIKey | LROSUTJPBMEPEY-UHFFFAOYSA-N |
| SMILES | C1COCCN1P(=O)(OCC(Br)(Br)Br)Cl |
Computed by PubChem (NCBI)