CAS 57583-53-6 appears in our catalog under these names: 2,6–Dihydroxypyrrolo(3,4–f)isoindole–1,3,5,7(2H,6H)–tetraone, N,N'-Dihydroxypyromellitimide, >96.0%(HPLC)(N), 2,6-Dihydroxypyrrolo(3,4-f)isoindole-1,3,5,7(2H,6H)-tetrone, 96%, 96%, 2,6-Dihydroxypyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetraone, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 200mg, 100mg, 250mg.
2,6-dihydroxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (CAS 57583-53-6) is a chemical compound with the molecular formula C10H4N2O6 and a molecular weight of 248.15 g/mol. IUPAC name: 2,6-dihydroxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone. InChIKey: VBBUVIWLZBAEEF-UHFFFAOYSA-N.
| Molecular formula | C10H4N2O6 |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 2,6-dihydroxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| InChIKey | VBBUVIWLZBAEEF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC3=C1C(=O)N(C3=O)O)C(=O)N(C2=O)O |
Computed by PubChem (NCBI)