CAS 576-42-1 appears in our catalog under these names: Potassium bisaccharate, 98%, Monopotassium D-Glucarate, D-Glucarate Monopotassium, >95% (HPLC), D–Glucaric acid potassium, D-Glucaric acid potassium. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 25g, 5g, 1g, on request, 100mg, 25mg, 50mg, 500mg.
Potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate (CAS 576-42-1) is a chemical compound with the molecular formula C6H9KO8 and a molecular weight of 248.23 g/mol. IUPAC name: potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate. InChIKey: UBYZGUWQNIEQMH-SBBOJQDXSA-M.
| Molecular formula | C6H9KO8 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate |
| InChIKey | UBYZGUWQNIEQMH-SBBOJQDXSA-M |
| SMILES | [C@H]([C@@H]([C@H](C(=O)[O-])O)O)([C@@H](C(=O)O)O)O.[K+] |
Computed by PubChem (NCBI)